C7H4Br2F5NO3S — CID 59642134
(3,5-dibromo-4-methoxy-2-nitrophenyl)-pentafluoro-λ6-sulfane (PubChem CID 59642134) has the molecular formula C7H4Br2F5NO3S and a molecular weight of 436.98 g/mol. Its IUPAC name is (3,5-dibromo-4-methoxy-2-nitrophenyl)-pentafluoro-λ6-sulfane.
| Compound Name | (3,5-dibromo-4-methoxy-2-nitrophenyl)-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 59642134 |
| Molecular Formula | C7H4Br2F5NO3S |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 434.82 |
| IUPAC Name | (3,5-dibromo-4-methoxy-2-nitrophenyl)-pentafluoro-λ6-sulfane |
| SMILES | COc1c(Br)cc(S(F)(F)(F)(F)F)c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C7H4Br2F5NO3S/c1-18-7-3(8)2-4(19(10,11,12,13)14)6(5(7)9)15(16)17/h2H,1H3 |
| InChIKey | GDUXGSGWLIGRBT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|