C12H17NO4S — CID 171875246
1-(2,4-dimethyl-6-nitrophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171875246) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(2,4-dimethyl-6-nitrophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2,4-dimethyl-6-nitrophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171875246 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(2,4-dimethyl-6-nitrophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Cc1cc(C)c(C(O)C(O)CCS)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17NO4S/c1-7-5-8(2)11(9(6-7)13(16)17)12(15)10(14)3-4-18/h5-6,10,12,14-15,18H,3-4H2,1-2H3 |
| InChIKey | DHAFMPSIEUOCNU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|