C19H26O3P+ — CID 70632558
bis(2,4,6-trimethylphenyl)methyl-trihydroxyphosphanium (PubChem CID 70632558) has the molecular formula C19H26O3P+ and a molecular weight of 333.39 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)methyl-trihydroxyphosphanium.
| Compound Name | bis(2,4,6-trimethylphenyl)methyl-trihydroxyphosphanium |
|---|---|
| PubChem CID | 70632558 |
| Molecular Formula | C19H26O3P+ |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)methyl-trihydroxyphosphanium |
| SMILES | Cc1cc(C)c(C(c2c(C)cc(C)cc2C)[P+](O)(O)O)c(C)c1 |
| InChI | InChI=1S/C19H26O3P/c1-11-7-13(3)17(14(4)8-11)19(23(20,21)22)18-15(5)9-12(2)10-16(18)6/h7-10,19-22H,1-6H3/q+1 |
| InChIKey | ZXTYMAAANOAPTH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|