C12H20PSi- — CID 12736255
(2,4,6-trimethylphenyl)-trimethylsilylphosphanide (PubChem CID 12736255) has the molecular formula C12H20PSi- and a molecular weight of 223.35 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)-trimethylsilylphosphanide.
| Compound Name | (2,4,6-trimethylphenyl)-trimethylsilylphosphanide |
|---|---|
| PubChem CID | 12736255 |
| Molecular Formula | C12H20PSi- |
| Molecular Weight | 223.35 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2,4,6-trimethylphenyl)-trimethylsilylphosphanide |
| SMILES | Cc1cc(C)c([P-][Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C12H20PSi/c1-9-7-10(2)12(11(3)8-9)13-14(4,5)6/h7-8H,1-6H3/q-1 |
| InChIKey | JDLINNXVKAPOHD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|