C18H38Si4 — CID 15655090
trimethyl-[(2,4,6-trimethylphenyl)-bis(trimethylsilyl)silyl]silane (PubChem CID 15655090) has the molecular formula C18H38Si4 and a molecular weight of 366.85 g/mol. Its IUPAC name is trimethyl-[(2,4,6-trimethylphenyl)-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[(2,4,6-trimethylphenyl)-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 15655090 |
| Molecular Formula | C18H38Si4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | trimethyl-[(2,4,6-trimethylphenyl)-bis(trimethylsilyl)silyl]silane |
| SMILES | Cc1cc(C)c([Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H38Si4/c1-15-13-16(2)18(17(3)14-15)22(19(4,5)6,20(7,8)9)21(10,11)12/h13-14H,1-12H3 |
| InChIKey | VCIPXDFXDOXLGM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|