C19H38BrSi4- — CID 102145892
bromo-(2,4,6-trimethylphenyl)-[tris(trimethylsilyl)methyl]silanide (PubChem CID 102145892) has the molecular formula C19H38BrSi4- and a molecular weight of 458.76 g/mol. Its IUPAC name is bromo-(2,4,6-trimethylphenyl)-[tris(trimethylsilyl)methyl]silanide.
| Compound Name | bromo-(2,4,6-trimethylphenyl)-[tris(trimethylsilyl)methyl]silanide |
|---|---|
| PubChem CID | 102145892 |
| Molecular Formula | C19H38BrSi4- |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | bromo-(2,4,6-trimethylphenyl)-[tris(trimethylsilyl)methyl]silanide |
| SMILES | Cc1cc(C)c([Si-](Br)C([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C19H38BrSi4/c1-15-13-16(2)18(17(3)14-15)21(20)19(22(4,5)6,23(7,8)9)24(10,11)12/h13-14H,1-12H3/q-1 |
| InChIKey | WNOGHRZKMULFAN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|