C17H36FN3Si3 — CID 23234630
N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2,4,6-trimethylaniline (PubChem CID 23234630) has the molecular formula C17H36FN3Si3 and a molecular weight of 385.75 g/mol. Its IUPAC name is N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2,4,6-trimethylaniline.
| Compound Name | N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 23234630 |
| Molecular Formula | C17H36FN3Si3 |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N[Si](F)(N(C)[Si](C)(C)C)N(C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H36FN3Si3/c1-14-12-15(2)17(16(3)13-14)19-24(18,20(4)22(6,7)8)21(5)23(9,10)11/h12-13,19H,1-11H3 |
| InChIKey | GAFGZSNUJLAMSW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|