C25H39N3 — CID 18441321
N'-methyl-N'-[3-(2,4,6-trimethylanilino)propyl]-N-(2,4,6-trimethylphenyl)propane-1,3-diamine (PubChem CID 18441321) has the molecular formula C25H39N3 and a molecular weight of 381.61 g/mol. Its IUPAC name is N'-methyl-N'-[3-(2,4,6-trimethylanilino)propyl]-N-(2,4,6-trimethylphenyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-[3-(2,4,6-trimethylanilino)propyl]-N-(2,4,6-trimethylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 18441321 |
| Molecular Formula | C25H39N3 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | N'-methyl-N'-[3-(2,4,6-trimethylanilino)propyl]-N-(2,4,6-trimethylphenyl)propane-1,3-diamine |
| SMILES | Cc1cc(C)c(NCCCN(C)CCCNc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C25H39N3/c1-18-14-20(3)24(21(4)15-18)26-10-8-12-28(7)13-9-11-27-25-22(5)16-19(2)17-23(25)6/h14-17,26-27H,8-13H2,1-7H3 |
| InChIKey | XSKVBYAHIPNYRX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|