C19H25BiF2 — CID 164733466
difluoro-methyl-bis(2,4,6-trimethylphenyl)bismuth (PubChem CID 164733466) has the molecular formula C19H25BiF2 and a molecular weight of 500.39 g/mol. Its IUPAC name is difluoro-methyl-bis(2,4,6-trimethylphenyl)bismuth.
| Compound Name | difluoro-methyl-bis(2,4,6-trimethylphenyl)bismuth |
|---|---|
| PubChem CID | 164733466 |
| Molecular Formula | C19H25BiF2 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | difluoro-methyl-bis(2,4,6-trimethylphenyl)bismuth |
| SMILES | Cc1cc(C)c([Bi](C)(F)(F)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/2C9H11.CH3.Bi.2FH/c2*1-7-4-8(2)6-9(3)5-7;;;;/h2*4-5H,1-3H3;1H3;;2*1H/q;;;+2;;/p-2 |
| InChIKey | ZFRIBSKLNCDRKY-UHFFFAOYSA-L |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |