C14H12Br2FNO — CID 106880546
(3,5-dibromo-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol (PubChem CID 106880546) has the molecular formula C14H12Br2FNO and a molecular weight of 389.06 g/mol. Its IUPAC name is (3,5-dibromo-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol.
| Compound Name | (3,5-dibromo-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106880546 |
| Molecular Formula | C14H12Br2FNO |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | (3,5-dibromo-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ncc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C14H12Br2FNO/c1-7-3-8(2)12(11(17)4-7)14(19)13-10(16)5-9(15)6-18-13/h3-6,14,19H,1-2H3 |
| InChIKey | QYPNXZZVIIDZMK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |