C14H13ClFNO — CID 106881129
(5-chloro-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol (PubChem CID 106881129) has the molecular formula C14H13ClFNO and a molecular weight of 265.72 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol.
| Compound Name | (5-chloro-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106881129 |
| Molecular Formula | C14H13ClFNO |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (5-chloro-2-pyridinyl)-(2-fluoro-4,6-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C14H13ClFNO/c1-8-5-9(2)13(11(16)6-8)14(18)12-4-3-10(15)7-17-12/h3-7,14,18H,1-2H3 |
| InChIKey | STJQFYUZBHFGLO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |