C54H66Si2Sn — CID 139112012
bis[2,6-bis(2,4,6-trimethylphenyl)-4-trimethylsilylphenyl]tin (PubChem CID 139112012) has the molecular formula C54H66Si2Sn and a molecular weight of 890.00 g/mol. Its IUPAC name is bis[2,6-bis(2,4,6-trimethylphenyl)-4-trimethylsilylphenyl]tin.
| Compound Name | bis[2,6-bis(2,4,6-trimethylphenyl)-4-trimethylsilylphenyl]tin |
|---|---|
| PubChem CID | 139112012 |
| Molecular Formula | C54H66Si2Sn |
| Molecular Weight | 890.00 g/mol |
| Exact Mass | 890.37 |
| IUPAC Name | bis[2,6-bis(2,4,6-trimethylphenyl)-4-trimethylsilylphenyl]tin |
| SMILES | Cc1cc(C)c(-c2cc([Si](C)(C)C)cc(-c3c(C)cc(C)cc3C)c2[Sn]c2c(-c3c(C)cc(C)cc3C)cc([Si](C)(C)C)cc2-c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/2C27H33Si.Sn/c2*1-17-10-19(3)26(20(4)11-17)23-14-24(16-25(15-23)28(7,8)9)27-21(5)12-18(2)13-22(27)6;/h2*10-13,15-16H,1-9H3; |
| InChIKey | MMDPSOFDUBCGFV-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.00 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|