C28H39ClSi3 — CID 88962741
chloro-(3,5-dimethylphenyl)-bis(3-methyl-5-trimethylsilylphenyl)silane (PubChem CID 88962741) has the molecular formula C28H39ClSi3 and a molecular weight of 495.33 g/mol. Its IUPAC name is chloro-(3,5-dimethylphenyl)-bis(3-methyl-5-trimethylsilylphenyl)silane.
| Compound Name | chloro-(3,5-dimethylphenyl)-bis(3-methyl-5-trimethylsilylphenyl)silane |
|---|---|
| PubChem CID | 88962741 |
| Molecular Formula | C28H39ClSi3 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | chloro-(3,5-dimethylphenyl)-bis(3-methyl-5-trimethylsilylphenyl)silane |
| SMILES | Cc1cc(C)cc([Si](Cl)(c2cc(C)cc([Si](C)(C)C)c2)c2cc(C)cc([Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C28H39ClSi3/c1-20-11-21(2)15-26(14-20)32(29,27-16-22(3)12-24(18-27)30(5,6)7)28-17-23(4)13-25(19-28)31(8,9)10/h11-19H,1-10H3 |
| InChIKey | HJYVIHBJIOBAJS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|