C25H33N2O+ — CID 102041303
4-[(2-methylpropan-2-yl)oxy]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium (PubChem CID 102041303) has the molecular formula C25H33N2O+ and a molecular weight of 377.55 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 102041303 |
| Molecular Formula | C25H33N2O+ |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium |
| SMILES | Cc1cc(C)c(-n2c[n+](-c3c(C)cc(C)cc3C)cc2OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C25H33N2O/c1-16-10-18(3)23(19(4)11-16)26-14-22(28-25(7,8)9)27(15-26)24-20(5)12-17(2)13-21(24)6/h10-15H,1-9H3/q+1 |
| InChIKey | KLAPBCMGOBMBQY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|