C25H31N2O3+ — CID 132511975
2-methoxyethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate (PubChem CID 132511975) has the molecular formula C25H31N2O3+ and a molecular weight of 407.53 g/mol. Its IUPAC name is 2-methoxyethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate.
| Compound Name | 2-methoxyethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 132511975 |
| Molecular Formula | C25H31N2O3+ |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-methoxyethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate |
| SMILES | COCCOC(=O)c1c[n+](-c2c(C)cc(C)cc2C)cn1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H31N2O3/c1-16-10-18(3)23(19(4)11-16)26-14-22(25(28)30-9-8-29-7)27(15-26)24-20(5)12-17(2)13-21(24)6/h10-15H,8-9H2,1-7H3/q+1 |
| InChIKey | NKMVRZOIUKJZEN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|