C15H18N2O2 — CID 114203645
ethyl 1-(2,4,6-trimethylphenyl)imidazole-4-carboxylate (PubChem CID 114203645) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl 1-(2,4,6-trimethylphenyl)imidazole-4-carboxylate.
| Compound Name | ethyl 1-(2,4,6-trimethylphenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 114203645 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | ethyl 1-(2,4,6-trimethylphenyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2c(C)cc(C)cc2C)cn1 |
| InChI | InChI=1S/C15H18N2O2/c1-5-19-15(18)13-8-17(9-16-13)14-11(3)6-10(2)7-12(14)4/h6-9H,5H2,1-4H3 |
| InChIKey | UZKMLRKYMYCNFH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |