2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid

C14H16N2O2 — CID 82478421

IUPAC2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid
SMILESCc1cc(C)c(-n2cnc(CC(=O)O)c2)c(C)c1
InChIInChI=1S/C14H16N2O2/c1-9-4-10(2)14(11(3)5-9)16-7-12(15-8-16)6-13(17)18/h4-5,7-8H,6H2,1-3H3,(H,17,18)
InChIKeyBEACPZFEZJRBMS-UHFFFAOYSA-N
MW244.29 g/mol
LogP2.42
Rot. Bonds3

About 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid

2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid (PubChem CID 82478421) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid
PubChem CID82478421
Molecular FormulaC14H16N2O2
Molecular Weight244.29 g/mol
Exact Mass244.12
IUPAC Name2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid
SMILESCc1cc(C)c(-n2cnc(CC(=O)O)c2)c(C)c1
InChIInChI=1S/C14H16N2O2/c1-9-4-10(2)14(11(3)5-9)16-7-12(15-8-16)6-13(17)18/h4-5,7-8H,6H2,1-3H3,(H,17,18)
InChIKeyBEACPZFEZJRBMS-UHFFFAOYSA-N
XLogP2.42
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid?
The IUPAC name of 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid (CID 82478421) is 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid?
The canonical SMILES for 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid is Cc1cc(C)c(-n2cnc(CC(=O)O)c2)c(C)c1.
What is the InChIKey of 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid?
The InChIKey is BEACPZFEZJRBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-9-4-10(2)14(11(3)5-9)16-7-12(15-8-16)6-13(17)18/h4-5,7-8H,6H2,1-3H3,(H,17,18).
What are the key properties of 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid?
2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid has a molecular weight of 244.29 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4,6-trimethylphenyl)imidazol-4-yl]acetic acid is sourced from PubChem (CID 82478421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).