C15H19N3O3 — CID 107461459
2-[1-[3-(3,5-dimethylphenoxy)propyl]triazol-4-yl]acetic acid (PubChem CID 107461459) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[1-[3-(3,5-dimethylphenoxy)propyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[3-(3,5-dimethylphenoxy)propyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461459 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[1-[3-(3,5-dimethylphenoxy)propyl]triazol-4-yl]acetic acid |
| SMILES | Cc1cc(C)cc(OCCCn2cc(CC(=O)O)nn2)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-6-12(2)8-14(7-11)21-5-3-4-18-10-13(16-17-18)9-15(19)20/h6-8,10H,3-5,9H2,1-2H3,(H,19,20) |
| InChIKey | UNVGWEFPXNREHV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|