C14H18BrN3O — CID 62394957
4-(2-bromoethyl)-1-[2-(3,5-dimethylphenoxy)ethyl]triazole (PubChem CID 62394957) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-(2-bromoethyl)-1-[2-(3,5-dimethylphenoxy)ethyl]triazole.
| Compound Name | 4-(2-bromoethyl)-1-[2-(3,5-dimethylphenoxy)ethyl]triazole |
|---|---|
| PubChem CID | 62394957 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-(2-bromoethyl)-1-[2-(3,5-dimethylphenoxy)ethyl]triazole |
| SMILES | Cc1cc(C)cc(OCCn2cc(CCBr)nn2)c1 |
| InChI | InChI=1S/C14H18BrN3O/c1-11-7-12(2)9-14(8-11)19-6-5-18-10-13(3-4-15)16-17-18/h7-10H,3-6H2,1-2H3 |
| InChIKey | MFOYWPNIOPQUBK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|