C15H20BrN3O — CID 62394415
4-(2-bromoethyl)-1-[3-(3,5-dimethylphenoxy)propyl]triazole (PubChem CID 62394415) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 4-(2-bromoethyl)-1-[3-(3,5-dimethylphenoxy)propyl]triazole.
| Compound Name | 4-(2-bromoethyl)-1-[3-(3,5-dimethylphenoxy)propyl]triazole |
|---|---|
| PubChem CID | 62394415 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-(2-bromoethyl)-1-[3-(3,5-dimethylphenoxy)propyl]triazole |
| SMILES | Cc1cc(C)cc(OCCCn2cc(CCBr)nn2)c1 |
| InChI | InChI=1S/C15H20BrN3O/c1-12-8-13(2)10-15(9-12)20-7-3-6-19-11-14(4-5-16)17-18-19/h8-11H,3-7H2,1-2H3 |
| InChIKey | FYQPWYSCTCCIKK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|