C24H29N2O2+ — CID 132511970
ethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate (PubChem CID 132511970) has the molecular formula C24H29N2O2+ and a molecular weight of 377.51 g/mol. Its IUPAC name is ethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate.
| Compound Name | ethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 132511970 |
| Molecular Formula | C24H29N2O2+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ethyl 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-4-carboxylate |
| SMILES | CCOC(=O)c1c[n+](-c2c(C)cc(C)cc2C)cn1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H29N2O2/c1-8-28-24(27)21-13-25(22-17(4)9-15(2)10-18(22)5)14-26(21)23-19(6)11-16(3)12-20(23)7/h9-14H,8H2,1-7H3/q+1 |
| InChIKey | OPTLUNIUJKWHQL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|