C25H34N2O2P+ — CID 102453560
[1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-diethoxyphosphane (PubChem CID 102453560) has the molecular formula C25H34N2O2P+ and a molecular weight of 425.53 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-diethoxyphosphane.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-diethoxyphosphane |
|---|---|
| PubChem CID | 102453560 |
| Molecular Formula | C25H34N2O2P+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium-2-yl]-diethoxyphosphane |
| SMILES | CCOP(OCC)c1n(-c2c(C)cc(C)cc2C)cc[n+]1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H34N2O2P/c1-9-28-30(29-10-2)25-26(23-19(5)13-17(3)14-20(23)6)11-12-27(25)24-21(7)15-18(4)16-22(24)8/h11-16H,9-10H2,1-8H3/q+1 |
| InChIKey | XSACEAPOPOSTPQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|