C32H37N2O+ — CID 132992065
2-[(Z)-3-ethoxy-1-phenylprop-2-enyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium (PubChem CID 132992065) has the molecular formula C32H37N2O+ and a molecular weight of 465.66 g/mol. Its IUPAC name is 2-[(Z)-3-ethoxy-1-phenylprop-2-enyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium.
| Compound Name | 2-[(Z)-3-ethoxy-1-phenylprop-2-enyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 132992065 |
| Molecular Formula | C32H37N2O+ |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 2-[(Z)-3-ethoxy-1-phenylprop-2-enyl]-1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium |
| SMILES | CCO/C=C\C(c1ccccc1)c1n(-c2c(C)cc(C)cc2C)cc[n+]1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C32H37N2O/c1-8-35-17-14-29(28-12-10-9-11-13-28)32-33(30-24(4)18-22(2)19-25(30)5)15-16-34(32)31-26(6)20-23(3)21-27(31)7/h9-21,29H,8H2,1-7H3/q+1/b17-14- |
| InChIKey | GHOUJQLEIKLDMS-VKAVYKQESA-N |
| XLogP | 7.29 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|