C23H30N2 — CID 25017163
Dr Athanasia Dervisi (PubChem CID 25017163) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol.
| Compound Name | Dr Athanasia Dervisi |
|---|---|
| PubChem CID | 25017163 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[C-]=[N+](c3c(C)cc(C)cc3C)CCCC2)c(C)c1 |
| InChI | InChI=1S/C23H30N2/c1-16-11-18(3)22(19(4)12-16)24-9-7-8-10-25(15-24)23-20(5)13-17(2)14-21(23)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | LUMAVDMUVNRYCA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|