About Dr Athanasia Dervisi
Dr Athanasia Dervisi (PubChem CID 25017163) has the molecular formula C23H30N2
and a molecular weight of 334.51 g/mol.
Molecular Properties
| Compound Name | Dr Athanasia Dervisi |
| PubChem CID | 25017163 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[C-]=[N+](c3c(C)cc(C)cc3C)CCCC2)c(C)c1 |
| InChI | InChI=1S/C23H30N2/c1-16-11-18(3)22(19(4)12-16)24-9-7-8-10-25(15-24)23-20(5)13-17(2)14-21(23)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | LUMAVDMUVNRYCA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze Dr Athanasia Dervisi with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dr Athanasia Dervisi?
The IUPAC name of Dr Athanasia Dervisi (CID 25017163) is not available.
What is the SMILES notation for Dr Athanasia Dervisi?
The canonical SMILES for Dr Athanasia Dervisi is Cc1cc(C)c(N2[C-]=[N+](c3c(C)cc(C)cc3C)CCCC2)c(C)c1.
What is the InChIKey of Dr Athanasia Dervisi?
The InChIKey is LUMAVDMUVNRYCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2/c1-16-11-18(3)22(19(4)12-16)24-9-7-8-10-25(15-24)23-20(5)13-17(2)14-21(23)6/h11-14H,7-10H2,1-6H3.
What are the key properties of Dr Athanasia Dervisi?
Dr Athanasia Dervisi has a molecular weight of 334.51 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Dr Athanasia Dervisi is sourced from PubChem (CID 25017163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).