C16H24N2 — CID 67835472
2-(2,4,6-trimethylphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrazolo[1,2-a]pyridazine (PubChem CID 67835472) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrazolo[1,2-a]pyridazine.
| Compound Name | 2-(2,4,6-trimethylphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrazolo[1,2-a]pyridazine |
|---|---|
| PubChem CID | 67835472 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrazolo[1,2-a]pyridazine |
| SMILES | Cc1cc(C)c(C2CN3CCCCN3C2)c(C)c1 |
| InChI | InChI=1S/C16H24N2/c1-12-8-13(2)16(14(3)9-12)15-10-17-6-4-5-7-18(17)11-15/h8-9,15H,4-7,10-11H2,1-3H3 |
| InChIKey | HEXYBRGTLZREAH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |