C25H33N2O2+ — CID 139244821
3,6,6-trimethyl-2,4-bis(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.1.0]hex-2-ene-1,5-diol (PubChem CID 139244821) has the molecular formula C25H33N2O2+ and a molecular weight of 393.55 g/mol. Its IUPAC name is 3,6,6-trimethyl-2,4-bis(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.1.0]hex-2-ene-1,5-diol.
| Compound Name | 3,6,6-trimethyl-2,4-bis(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.1.0]hex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 139244821 |
| Molecular Formula | C25H33N2O2+ |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 3,6,6-trimethyl-2,4-bis(2,4,6-trimethylphenyl)-4-aza-2-azoniabicyclo[3.1.0]hex-2-ene-1,5-diol |
| SMILES | CC1=[N+](c2c(C)cc(C)cc2C)C2(O)C(C)(C)C2(O)N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H33N2O2/c1-14-10-16(3)21(17(4)11-14)26-20(7)27(25(29)23(8,9)24(25,26)28)22-18(5)12-15(2)13-19(22)6/h10-13,28-29H,1-9H3/q+1 |
| InChIKey | ZHQLNWSRISRTMJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|