C28H33N3O2 — CID 56588003
2,6,6-trimethyl-5,7-dioxo-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]octane-2-carbonitrile (PubChem CID 56588003) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2,6,6-trimethyl-5,7-dioxo-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]octane-2-carbonitrile.
| Compound Name | 2,6,6-trimethyl-5,7-dioxo-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]octane-2-carbonitrile |
|---|---|
| PubChem CID | 56588003 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2,6,6-trimethyl-5,7-dioxo-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]octane-2-carbonitrile |
| SMILES | Cc1cc(C)c(N2C(=O)C(C)(C)C(=O)N(c3c(C)cc(C)cc3C)C23CC3(C)C#N)c(C)c1 |
| InChI | InChI=1S/C28H33N3O2/c1-16-10-18(3)22(19(4)11-16)30-24(32)26(7,8)25(33)31(28(30)14-27(28,9)15-29)23-20(5)12-17(2)13-21(23)6/h10-13H,14H2,1-9H3 |
| InChIKey | DNNXVTDAGGDYNN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|