C34H38N2O2 — CID 57407509
1-ethyl-6,6-dimethyl-2-phenyl-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]oct-1-ene-5,7-dione (PubChem CID 57407509) has the molecular formula C34H38N2O2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 1-ethyl-6,6-dimethyl-2-phenyl-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]oct-1-ene-5,7-dione.
| Compound Name | 1-ethyl-6,6-dimethyl-2-phenyl-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]oct-1-ene-5,7-dione |
|---|---|
| PubChem CID | 57407509 |
| Molecular Formula | C34H38N2O2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 1-ethyl-6,6-dimethyl-2-phenyl-4,8-bis(2,4,6-trimethylphenyl)-4,8-diazaspiro[2.5]oct-1-ene-5,7-dione |
| SMILES | CCC1=C(c2ccccc2)C12N(c1c(C)cc(C)cc1C)C(=O)C(C)(C)C(=O)N2c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C34H38N2O2/c1-10-27-28(26-14-12-11-13-15-26)34(27)35(29-22(4)16-20(2)17-23(29)5)31(37)33(8,9)32(38)36(34)30-24(6)18-21(3)19-25(30)7/h11-19H,10H2,1-9H3 |
| InChIKey | RAJWIWSGDWVMBX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|