C39H48B2Cl2N2 — CID 135074188
bis(2,4,6-trimethylphenyl)boranyl-[1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]-dichloroboranuide (PubChem CID 135074188) has the molecular formula C39H48B2Cl2N2 and a molecular weight of 637.36 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)boranyl-[1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]-dichloroboranuide.
| Compound Name | bis(2,4,6-trimethylphenyl)boranyl-[1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]-dichloroboranuide |
|---|---|
| PubChem CID | 135074188 |
| Molecular Formula | C39H48B2Cl2N2 |
| Molecular Weight | 637.36 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)boranyl-[1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]-dichloroboranuide |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)[B-](Cl)(Cl)C2=[N+](c3c(C)cc(C)cc3C)CCN2c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C39H48B2Cl2N2/c1-23-15-27(5)35(28(6)16-23)40(36-29(7)17-24(2)18-30(36)8)41(42,43)39-44(37-31(9)19-25(3)20-32(37)10)13-14-45(39)38-33(11)21-26(4)22-34(38)12/h15-22H,13-14H2,1-12H3 |
| InChIKey | MSTKTVGRTDDLSI-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.36 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|