C21H28N3V+ — CID 175973567
1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine;vanadium (PubChem CID 175973567) has the molecular formula C21H28N3V+ and a molecular weight of 373.42 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine;vanadium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine;vanadium |
|---|---|
| PubChem CID | 175973567 |
| Molecular Formula | C21H28N3V+ |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine;vanadium |
| SMILES | Cc1cc(C)c(N2CC(N)=[N+](c3c(C)cc(C)cc3C)C2)c(C)c1.[V] |
| InChI | InChI=1S/C21H27N3.V/c1-13-7-15(3)20(16(4)8-13)23-11-19(22)24(12-23)21-17(5)9-14(2)10-18(21)6;/h7-10,22H,11-12H2,1-6H3;/p+1 |
| InChIKey | PIEZQRWBCPLNGD-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|