C29H36N3O+ — CID 175886673
2-(2,6-dimethylphenoxy)-1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine (PubChem CID 175886673) has the molecular formula C29H36N3O+ and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine.
| Compound Name | 2-(2,6-dimethylphenoxy)-1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine |
|---|---|
| PubChem CID | 175886673 |
| Molecular Formula | C29H36N3O+ |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-1-ium-5-amine |
| SMILES | Cc1cc(C)c(N2CC(N)=[N+](c3c(C)cc(C)cc3C)C2Oc2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C29H35N3O/c1-17-12-21(5)26(22(6)13-17)31-16-25(30)32(27-23(7)14-18(2)15-24(27)8)29(31)33-28-19(3)10-9-11-20(28)4/h9-15,29-30H,16H2,1-8H3/p+1 |
| InChIKey | OHZGAJLLGRYULY-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 41.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|