C19H22ClN2+ — CID 122646856
2-chloro-1-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium (PubChem CID 122646856) has the molecular formula C19H22ClN2+ and a molecular weight of 313.85 g/mol. Its IUPAC name is 2-chloro-1-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium.
| Compound Name | 2-chloro-1-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 122646856 |
| Molecular Formula | C19H22ClN2+ |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-chloro-1-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium |
| SMILES | Cc1cc(C)c([N+]2=C(Cl)N(c3ccccc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22ClN2/c1-13-11-15(3)18(16(4)12-13)22-10-9-21(19(22)20)17-8-6-5-7-14(17)2/h5-8,11-12H,9-10H2,1-4H3/q+1 |
| InChIKey | QDFMVRHNYVQMMO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|