About 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride
4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride (PubChem CID 173073236) has the molecular formula C12H16ClNS
and a molecular weight of 241.79 g/mol. Its IUPAC name is 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride |
| PubChem CID | 173073236 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride |
| SMILES | CC1=C(C)N(c2ccccc2C)CS1.Cl |
| InChI | InChI=1S/C12H15NS.ClH/c1-9-6-4-5-7-12(9)13-8-14-11(3)10(13)2;/h4-7H,8H2,1-3H3;1H |
| InChIKey | DGJAEDJRFQODNM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride?
The IUPAC name of 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride (CID 173073236) is 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride.
What is the SMILES notation for 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride?
The canonical SMILES for 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride is CC1=C(C)N(c2ccccc2C)CS1.Cl.
What is the InChIKey of 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride?
The InChIKey is DGJAEDJRFQODNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS.ClH/c1-9-6-4-5-7-12(9)13-8-14-11(3)10(13)2;/h4-7H,8H2,1-3H3;1H.
What are the key properties of 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride?
4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride has a molecular weight of 241.79 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-(2-methylphenyl)-2H-1,3-thiazole;hydrochloride is sourced from PubChem (CID 173073236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).