C12H14N2O — CID 84776854
3-(2-methylphenyl)-3,6-diazabicyclo[3.1.1]heptan-2-one (PubChem CID 84776854) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-(2-methylphenyl)-3,6-diazabicyclo[3.1.1]heptan-2-one.
| Compound Name | 3-(2-methylphenyl)-3,6-diazabicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 84776854 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-(2-methylphenyl)-3,6-diazabicyclo[3.1.1]heptan-2-one |
| SMILES | Cc1ccccc1N1CC2CC(N2)C1=O |
| InChI | InChI=1S/C12H14N2O/c1-8-4-2-3-5-11(8)14-7-9-6-10(13-9)12(14)15/h2-5,9-10,13H,6-7H2,1H3 |
| InChIKey | STXBAVBNMHJSFM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |