C11H15N3OS — CID 174787202
azane;3-(2-methylphenyl)-2H-1,3-thiazole-4-carboxamide (PubChem CID 174787202) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is azane;3-(2-methylphenyl)-2H-1,3-thiazole-4-carboxamide.
| Compound Name | azane;3-(2-methylphenyl)-2H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 174787202 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | azane;3-(2-methylphenyl)-2H-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccccc1N1CSC=C1C(N)=O.N |
| InChI | InChI=1S/C11H12N2OS.H3N/c1-8-4-2-3-5-9(8)13-7-15-6-10(13)11(12)14;/h2-6H,7H2,1H3,(H2,12,14);1H3 |
| InChIKey | LUNWWPYJTJFTLW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |