C29H35N2+ — CID 139182742
(4R)-5,5-dimethyl-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4H-imidazol-3-ium (PubChem CID 139182742) has the molecular formula C29H35N2+ and a molecular weight of 411.61 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4H-imidazol-3-ium.
| Compound Name | (4R)-5,5-dimethyl-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4H-imidazol-3-ium |
|---|---|
| PubChem CID | 139182742 |
| Molecular Formula | C29H35N2+ |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (4R)-5,5-dimethyl-4-phenyl-1,3-bis(2,4,6-trimethylphenyl)-4H-imidazol-3-ium |
| SMILES | Cc1cc(C)c(N2C=[N+](c3c(C)cc(C)cc3C)[C@H](c3ccccc3)C2(C)C)c(C)c1 |
| InChI | InChI=1S/C29H35N2/c1-19-14-21(3)26(22(4)15-19)30-18-31(27-23(5)16-20(2)17-24(27)6)29(7,8)28(30)25-12-10-9-11-13-25/h9-18,28H,1-8H3/q+1/t28-/m1/s1 |
| InChIKey | NRZRZXHFGFMPOU-MUUNZHRXSA-N |
| XLogP | 7.25 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|