C28H39N2O+ — CID 135061449
3-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-trimethylphenyl)-5,6,7,7a-tetrahydro-4H-benzimidazol-1-ium-3a-ol (PubChem CID 135061449) has the molecular formula C28H39N2O+ and a molecular weight of 419.63 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-trimethylphenyl)-5,6,7,7a-tetrahydro-4H-benzimidazol-1-ium-3a-ol.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-trimethylphenyl)-5,6,7,7a-tetrahydro-4H-benzimidazol-1-ium-3a-ol |
|---|---|
| PubChem CID | 135061449 |
| Molecular Formula | C28H39N2O+ |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-(2,4,6-trimethylphenyl)-5,6,7,7a-tetrahydro-4H-benzimidazol-1-ium-3a-ol |
| SMILES | Cc1cc(C)c([N+]2=CN(c3c(C(C)C)cccc3C(C)C)C3(O)CCCCC23)c(C)c1 |
| InChI | InChI=1S/C28H39N2O/c1-18(2)23-11-10-12-24(19(3)4)27(23)30-17-29(25-13-8-9-14-28(25,30)31)26-21(6)15-20(5)16-22(26)7/h10-12,15-19,25,31H,8-9,13-14H2,1-7H3/q+1 |
| InChIKey | ATHHHVIGGQVPKZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|