C27H35Cl3N2 — CID 175762121
2,2,4-trichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazole (PubChem CID 175762121) has the molecular formula C27H35Cl3N2 and a molecular weight of 493.95 g/mol. Its IUPAC name is 2,2,4-trichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazole.
| Compound Name | 2,2,4-trichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazole |
|---|---|
| PubChem CID | 175762121 |
| Molecular Formula | C27H35Cl3N2 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2,2,4-trichloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazole |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=C(Cl)N(c2c(C(C)C)cccc2C(C)C)C1(Cl)Cl |
| InChI | InChI=1S/C27H35Cl3N2/c1-16(2)20-11-9-12-21(17(3)4)25(20)31-15-24(28)32(27(31,29)30)26-22(18(5)6)13-10-14-23(26)19(7)8/h9-19H,1-8H3 |
| InChIKey | GKNGILBQDSWQFS-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|