C29H40ClN — CID 175955451
3-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-dihydropyridine (PubChem CID 175955451) has the molecular formula C29H40ClN and a molecular weight of 438.10 g/mol. Its IUPAC name is 3-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-dihydropyridine.
| Compound Name | 3-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-dihydropyridine |
|---|---|
| PubChem CID | 175955451 |
| Molecular Formula | C29H40ClN |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-dihydropyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CCC(Cl)(c2c(C(C)C)cccc2C(C)C)C1 |
| InChI | InChI=1S/C29H40ClN/c1-19(2)23-12-9-13-24(20(3)4)27(23)29(30)16-11-17-31(18-29)28-25(21(5)6)14-10-15-26(28)22(7)8/h9-15,17,19-22H,16,18H2,1-8H3 |
| InChIKey | LPCFDYMAGUJOJS-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.10 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|