C12H17Cl3Ge — CID 15200932
trichloro-[2,6-di(propan-2-yl)phenyl]germane (PubChem CID 15200932) has the molecular formula C12H17Cl3Ge and a molecular weight of 340.24 g/mol. Its IUPAC name is trichloro-[2,6-di(propan-2-yl)phenyl]germane.
| Compound Name | trichloro-[2,6-di(propan-2-yl)phenyl]germane |
|---|---|
| PubChem CID | 15200932 |
| Molecular Formula | C12H17Cl3Ge |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | trichloro-[2,6-di(propan-2-yl)phenyl]germane |
| SMILES | CC(C)c1cccc(C(C)C)c1[Ge](Cl)(Cl)Cl |
| InChI | InChI=1S/C12H17Cl3Ge/c1-8(2)10-6-5-7-11(9(3)4)12(10)16(13,14)15/h5-9H,1-4H3 |
| InChIKey | DNCLYKSTSVXJLP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |