C24H34P- — CID 139171604
bis[2,6-di(propan-2-yl)phenyl]phosphanide (PubChem CID 139171604) has the molecular formula C24H34P- and a molecular weight of 353.51 g/mol. Its IUPAC name is bis[2,6-di(propan-2-yl)phenyl]phosphanide.
| Compound Name | bis[2,6-di(propan-2-yl)phenyl]phosphanide |
|---|---|
| PubChem CID | 139171604 |
| Molecular Formula | C24H34P- |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | bis[2,6-di(propan-2-yl)phenyl]phosphanide |
| SMILES | CC(C)c1cccc(C(C)C)c1[P-]c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C24H34P/c1-15(2)19-11-9-12-20(16(3)4)23(19)25-24-21(17(5)6)13-10-14-22(24)18(7)8/h9-18H,1-8H3/q-1 |
| InChIKey | OQZFJWLDQMLDOK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|