C22H28N+ — CID 153434958
2,2,4-trimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)-3H-pyrrol-1-ium (PubChem CID 153434958) has the molecular formula C22H28N+ and a molecular weight of 306.47 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)-3H-pyrrol-1-ium.
| Compound Name | 2,2,4-trimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 153434958 |
| Molecular Formula | C22H28N+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2,2,4-trimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)-3H-pyrrol-1-ium |
| SMILES | Cc1cc(C)c([N+]2=CC(C)(c3ccccc3)CC2(C)C)c(C)c1 |
| InChI | InChI=1S/C22H28N/c1-16-12-17(2)20(18(3)13-16)23-15-22(6,14-21(23,4)5)19-10-8-7-9-11-19/h7-13,15H,14H2,1-6H3/q+1 |
| InChIKey | GITFSTABYNRDOV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|