C17H17FO — CID 101068942
2-(3-fluorophenyl)-4,6-dimethyl-1,3-dihydroinden-2-ol (PubChem CID 101068942) has the molecular formula C17H17FO and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,6-dimethyl-1,3-dihydroinden-2-ol.
| Compound Name | 2-(3-fluorophenyl)-4,6-dimethyl-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 101068942 |
| Molecular Formula | C17H17FO |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(3-fluorophenyl)-4,6-dimethyl-1,3-dihydroinden-2-ol |
| SMILES | Cc1cc(C)c2c(c1)CC(O)(c1cccc(F)c1)C2 |
| InChI | InChI=1S/C17H17FO/c1-11-6-12(2)16-10-17(19,9-13(16)7-11)14-4-3-5-15(18)8-14/h3-8,19H,9-10H2,1-2H3 |
| InChIKey | UEVZBHMDFCMZNO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |