C16H24N+ — CID 171462893
1-(2,6-dimethylphenyl)-2,2,4,4-tetramethyl-3H-pyrrol-1-ium (PubChem CID 171462893) has the molecular formula C16H24N+ and a molecular weight of 230.37 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2,2,4,4-tetramethyl-3H-pyrrol-1-ium.
| Compound Name | 1-(2,6-dimethylphenyl)-2,2,4,4-tetramethyl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 171462893 |
| Molecular Formula | C16H24N+ |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2,2,4,4-tetramethyl-3H-pyrrol-1-ium |
| SMILES | Cc1cccc(C)c1[N+]1=CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C16H24N/c1-12-8-7-9-13(2)14(12)17-11-15(3,4)10-16(17,5)6/h7-9,11H,10H2,1-6H3/q+1 |
| InChIKey | OAISCNHZTNULFU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|