C21H28N+ — CID 167496237
4-[(3E)-hexa-1,3,5-trien-3-yl]-2,2-dimethyl-1-(2,4,6-trimethylphenyl)-3,4-dihydropyrrol-1-ium (PubChem CID 167496237) has the molecular formula C21H28N+ and a molecular weight of 294.46 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-2,2-dimethyl-1-(2,4,6-trimethylphenyl)-3,4-dihydropyrrol-1-ium.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-2,2-dimethyl-1-(2,4,6-trimethylphenyl)-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 167496237 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-2,2-dimethyl-1-(2,4,6-trimethylphenyl)-3,4-dihydropyrrol-1-ium |
| SMILES | C=C/C=C(\C=C)C1C=[N+](c2c(C)cc(C)cc2C)C(C)(C)C1 |
| InChI | InChI=1S/C21H28N/c1-8-10-18(9-2)19-13-21(6,7)22(14-19)20-16(4)11-15(3)12-17(20)5/h8-12,14,19H,1-2,13H2,3-7H3/q+1/b18-10+ |
| InChIKey | VRSGANSZMXNNMD-VCHYOVAHSA-N |
| XLogP | 5.42 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|