C19H25N — CID 178029174
2-[(2E)-2-ethenylpenta-2,4-dienyl]-1,1,6-trimethyl-3,4-dihydroisoquinoline (PubChem CID 178029174) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1,1,6-trimethyl-3,4-dihydroisoquinoline.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1,1,6-trimethyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 178029174 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1,1,6-trimethyl-3,4-dihydroisoquinoline |
| SMILES | C=C/C=C(\C=C)CN1CCc2cc(C)ccc2C1(C)C |
| InChI | InChI=1S/C19H25N/c1-6-8-16(7-2)14-20-12-11-17-13-15(3)9-10-18(17)19(20,4)5/h6-10,13H,1-2,11-12,14H2,3-5H3/b16-8+ |
| InChIKey | YEEIVVYSLNZIBZ-LZYBPNLTSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|