C14H22N2O — CID 171523229
ethane;2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide (PubChem CID 171523229) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is ethane;2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide.
| Compound Name | ethane;2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 171523229 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | ethane;2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
| SMILES | CC.Cc1ccc2c(c1)CN(CC(N)=O)CC2 |
| InChI | InChI=1S/C12H16N2O.C2H6/c1-9-2-3-10-4-5-14(8-12(13)15)7-11(10)6-9;1-2/h2-3,6H,4-5,7-8H2,1H3,(H2,13,15);1-2H3 |
| InChIKey | RHOSYKNNUTUEMN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |