C12H16N2O — CID 110456723
2-(5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide (PubChem CID 110456723) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide.
| Compound Name | 2-(5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 110456723 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
| SMILES | Cc1cccc2c1CCN(CC(N)=O)C2 |
| InChI | InChI=1S/C12H16N2O/c1-9-3-2-4-10-7-14(8-12(13)15)6-5-11(9)10/h2-4H,5-8H2,1H3,(H2,13,15) |
| InChIKey | GTYPBWCFSSKSOZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |