C20H25BN2O3 — CID 142595860
[1-[[2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]boronic acid (PubChem CID 142595860) has the molecular formula C20H25BN2O3 and a molecular weight of 352.24 g/mol. Its IUPAC name is [1-[[2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[[2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 142595860 |
| Molecular Formula | C20H25BN2O3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [1-[[2-(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)acetyl]amino]-2-phenylethyl]boronic acid |
| SMILES | Cc1ccc2c(c1)CN(CC(=O)NC(Cc1ccccc1)B(O)O)CC2 |
| InChI | InChI=1S/C20H25BN2O3/c1-15-7-8-17-9-10-23(13-18(17)11-15)14-20(24)22-19(21(25)26)12-16-5-3-2-4-6-16/h2-8,11,19,25-26H,9-10,12-14H2,1H3,(H,22,24) |
| InChIKey | MXXOZZAZIYBNDR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|