C16H19NS — CID 145149159
2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-3,4-dihydro-1H-isoquinoline (PubChem CID 145149159) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 145149159 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=C/C=C(\C=C)CSN1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H19NS/c1-3-7-14(4-2)13-18-17-11-10-15-8-5-6-9-16(15)12-17/h3-9H,1-2,10-13H2/b14-7+ |
| InChIKey | VXJNPBSYUSFFHS-VGOFMYFVSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|